C3H5CuO8S-3 — CID 158883106
copper;2,3-dihydroxypropanoate;sulfate (PubChem CID 158883106) has the molecular formula C3H5CuO8S-3 and a molecular weight of 264.68 g/mol. Its IUPAC name is copper;2,3-dihydroxypropanoate;sulfate.
| Compound Name | copper;2,3-dihydroxypropanoate;sulfate |
|---|---|
| PubChem CID | 158883106 |
| Molecular Formula | C3H5CuO8S-3 |
| Molecular Weight | 264.68 g/mol |
| Exact Mass | 263.90 |
| IUPAC Name | copper;2,3-dihydroxypropanoate;sulfate |
| SMILES | O=C([O-])C(O)CO.O=S(=O)([O-])[O-].[Cu] |
| InChI | InChI=1S/C3H6O4.Cu.H2O4S/c4-1-2(5)3(6)7;;1-5(2,3)4/h2,4-5H,1H2,(H,6,7);;(H2,1,2,3,4)/p-3 |
| InChIKey | AHRYRAUHBNBIIL-UHFFFAOYSA-K |
| XLogP | -4.25 |
| TPSA | 160.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.68 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|