About tetrakis(hydroxymethyl)phosphanium;urea;sulfate
tetrakis(hydroxymethyl)phosphanium;urea;sulfate (PubChem CID 156595491) has the molecular formula C5H16N2O9PS-
and a molecular weight of 311.23 g/mol. Its IUPAC name is tetrakis(hydroxymethyl)phosphanium;urea;sulfate.
Molecular Properties
| Compound Name | tetrakis(hydroxymethyl)phosphanium;urea;sulfate |
| PubChem CID | 156595491 |
| Molecular Formula | C5H16N2O9PS- |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | tetrakis(hydroxymethyl)phosphanium;urea;sulfate |
| SMILES | NC(N)=O.O=S(=O)([O-])[O-].OC[P+](CO)(CO)CO |
| InChI | InChI=1S/C4H12O4P.CH4N2O.H2O4S/c5-1-9(2-6,3-7)4-8;2-1(3)4;1-5(2,3)4/h5-8H,1-4H2;(H4,2,3,4);(H2,1,2,3,4)/q+1;;/p-2 |
| InChIKey | UMQVFBAWZJWILK-UHFFFAOYSA-L |
| XLogP | -3.51 |
| TPSA | 230.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(hydroxymethyl)phosphanium;urea;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(hydroxymethyl)phosphanium;urea;sulfate?
The IUPAC name of tetrakis(hydroxymethyl)phosphanium;urea;sulfate (CID 156595491) is tetrakis(hydroxymethyl)phosphanium;urea;sulfate.
What is the SMILES notation for tetrakis(hydroxymethyl)phosphanium;urea;sulfate?
The canonical SMILES for tetrakis(hydroxymethyl)phosphanium;urea;sulfate is NC(N)=O.O=S(=O)([O-])[O-].OC[P+](CO)(CO)CO.
What is the InChIKey of tetrakis(hydroxymethyl)phosphanium;urea;sulfate?
The InChIKey is UMQVFBAWZJWILK-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H12O4P.CH4N2O.H2O4S/c5-1-9(2-6,3-7)4-8;2-1(3)4;1-5(2,3)4/h5-8H,1-4H2;(H4,2,3,4);(H2,1,2,3,4)/q+1;;/p-2.
What are the key properties of tetrakis(hydroxymethyl)phosphanium;urea;sulfate?
tetrakis(hydroxymethyl)phosphanium;urea;sulfate has a molecular weight of 311.23 g/mol, XLogP of -3.51, 4 rotatable bonds, 6 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(hydroxymethyl)phosphanium;urea;sulfate is sourced from PubChem (CID 156595491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).