C5H17N2O9PS — CID 138400233
carbamimidate;sulfuric acid;tetrakis(hydroxymethyl)phosphanium (PubChem CID 138400233) has the molecular formula C5H17N2O9PS and a molecular weight of 312.24 g/mol. Its IUPAC name is carbamimidate;sulfuric acid;tetrakis(hydroxymethyl)phosphanium.
| Compound Name | carbamimidate;sulfuric acid;tetrakis(hydroxymethyl)phosphanium |
|---|---|
| PubChem CID | 138400233 |
| Molecular Formula | C5H17N2O9PS |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | carbamimidate;sulfuric acid;tetrakis(hydroxymethyl)phosphanium |
| SMILES | O=S(=O)(O)O.OC[P+](CO)(CO)CO.[H]/N=C(/N)[O-] |
| InChI | InChI=1S/C4H12O4P.CH4N2O.H2O4S/c5-1-9(2-6,3-7)4-8;2-1(3)4;1-5(2,3)4/h5-8H,1-4H2;(H4,2,3,4);(H2,1,2,3,4)/q+1;;/p-1 |
| InChIKey | UMQVFBAWZJWILK-UHFFFAOYSA-M |
| XLogP | -3.61 |
| TPSA | 228.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|