C5H12N2O3S — CID 141155185
1-amino-1-iminopentane-2-sulfonic acid (PubChem CID 141155185) has the molecular formula C5H12N2O3S and a molecular weight of 180.23 g/mol. Its IUPAC name is 1-amino-1-iminopentane-2-sulfonic acid.
| Compound Name | 1-amino-1-iminopentane-2-sulfonic acid |
|---|---|
| PubChem CID | 141155185 |
| Molecular Formula | C5H12N2O3S |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 1-amino-1-iminopentane-2-sulfonic acid |
| SMILES | [H]/N=C(\N)C(CCC)S(=O)(=O)O |
| InChI | InChI=1S/C5H12N2O3S/c1-2-3-4(5(6)7)11(8,9)10/h4H,2-3H2,1H3,(H3,6,7)(H,8,9,10) |
| InChIKey | YWPFGXNUIRNDTG-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|