C22H47NO4PS+ — CID 19803326
2-carbamoylpent-1-ene-3-sulfonic acid;tetrabutylphosphanium (PubChem CID 19803326) has the molecular formula C22H47NO4PS+ and a molecular weight of 452.66 g/mol. Its IUPAC name is 2-carbamoylpent-1-ene-3-sulfonic acid;tetrabutylphosphanium.
| Compound Name | 2-carbamoylpent-1-ene-3-sulfonic acid;tetrabutylphosphanium |
|---|---|
| PubChem CID | 19803326 |
| Molecular Formula | C22H47NO4PS+ |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | 2-carbamoylpent-1-ene-3-sulfonic acid;tetrabutylphosphanium |
| SMILES | C=C(C(N)=O)C(CC)S(=O)(=O)O.CCCC[P+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36P.C6H11NO4S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-3-5(12(9,10)11)4(2)6(7)8/h5-16H2,1-4H3;5H,2-3H2,1H3,(H2,7,8)(H,9,10,11)/q+1; |
| InChIKey | XEUXPIMCHSXDQQ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|