About 4-oxononane-3-sulfonic acid
4-oxononane-3-sulfonic acid (PubChem CID 174768626) has the molecular formula C9H18O4S
and a molecular weight of 222.31 g/mol. Its IUPAC name is 4-oxononane-3-sulfonic acid.
Molecular Properties
| Compound Name | 4-oxononane-3-sulfonic acid |
| PubChem CID | 174768626 |
| Molecular Formula | C9H18O4S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-oxononane-3-sulfonic acid |
| SMILES | CCCCCC(=O)C(CC)S(=O)(=O)O |
| InChI | InChI=1S/C9H18O4S/c1-3-5-6-7-8(10)9(4-2)14(11,12)13/h9H,3-7H2,1-2H3,(H,11,12,13) |
| InChIKey | IAOOMSVFXRHPAU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-oxononane-3-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxononane-3-sulfonic acid?
The IUPAC name of 4-oxononane-3-sulfonic acid (CID 174768626) is 4-oxononane-3-sulfonic acid.
What is the SMILES notation for 4-oxononane-3-sulfonic acid?
The canonical SMILES for 4-oxononane-3-sulfonic acid is CCCCCC(=O)C(CC)S(=O)(=O)O.
What is the InChIKey of 4-oxononane-3-sulfonic acid?
The InChIKey is IAOOMSVFXRHPAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4S/c1-3-5-6-7-8(10)9(4-2)14(11,12)13/h9H,3-7H2,1-2H3,(H,11,12,13).
What are the key properties of 4-oxononane-3-sulfonic acid?
4-oxononane-3-sulfonic acid has a molecular weight of 222.31 g/mol, XLogP of 1.80, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxononane-3-sulfonic acid is sourced from PubChem (CID 174768626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).