C13H20Na2O7S — CID 88842367
disodium;(E)-2-hexyl-3-(1-sulfopropyl)but-2-enedioate (PubChem CID 88842367) has the molecular formula C13H20Na2O7S and a molecular weight of 366.34 g/mol. Its IUPAC name is disodium;(E)-2-hexyl-3-(1-sulfopropyl)but-2-enedioate.
| Compound Name | disodium;(E)-2-hexyl-3-(1-sulfopropyl)but-2-enedioate |
|---|---|
| PubChem CID | 88842367 |
| Molecular Formula | C13H20Na2O7S |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | disodium;(E)-2-hexyl-3-(1-sulfopropyl)but-2-enedioate |
| SMILES | CCCCCC/C(C(=O)[O-])=C(/C(=O)[O-])C(CC)S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C13H22O7S.2Na/c1-3-5-6-7-8-9(12(14)15)11(13(16)17)10(4-2)21(18,19)20;;/h10H,3-8H2,1-2H3,(H,14,15)(H,16,17)(H,18,19,20);;/q;2*+1/p-2/b11-9-;; |
| InChIKey | RTNKKVOJYBBFMT-WSELPHFCSA-L |
| XLogP | -6.57 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | -6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|