C22H40O4Sn — CID 88746683
dimethyltin(2+);(Z)-2,3-dioctylbut-2-enedioate (PubChem CID 88746683) has the molecular formula C22H40O4Sn and a molecular weight of 487.27 g/mol. Its IUPAC name is dimethyltin(2+);(Z)-2,3-dioctylbut-2-enedioate.
| Compound Name | dimethyltin(2+);(Z)-2,3-dioctylbut-2-enedioate |
|---|---|
| PubChem CID | 88746683 |
| Molecular Formula | C22H40O4Sn |
| Molecular Weight | 487.27 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | dimethyltin(2+);(Z)-2,3-dioctylbut-2-enedioate |
| SMILES | CCCCCCCC/C(C(=O)[O-])=C(\CCCCCCCC)C(=O)[O-].C[Sn+2]C |
| InChI | InChI=1S/C20H36O4.2CH3.Sn/c1-3-5-7-9-11-13-15-17(19(21)22)18(20(23)24)16-14-12-10-8-6-4-2;;;/h3-16H2,1-2H3,(H,21,22)(H,23,24);2*1H3;/q;;;+2/p-2/b18-17-;;; |
| InChIKey | KKBIEQVJDMKQHB-IJRZPAASSA-L |
| XLogP | 4.07 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|