C28H52O4Sn — CID 22065655
dibutyltin(2+);(Z)-2,3-dioctylbut-2-enedioate (PubChem CID 22065655) has the molecular formula C28H52O4Sn and a molecular weight of 571.43 g/mol. Its IUPAC name is dibutyltin(2+);(Z)-2,3-dioctylbut-2-enedioate.
| Compound Name | dibutyltin(2+);(Z)-2,3-dioctylbut-2-enedioate |
|---|---|
| PubChem CID | 22065655 |
| Molecular Formula | C28H52O4Sn |
| Molecular Weight | 571.43 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | dibutyltin(2+);(Z)-2,3-dioctylbut-2-enedioate |
| SMILES | CCCCCCCC/C(C(=O)[O-])=C(\CCCCCCCC)C(=O)[O-].CCCC[Sn+2]CCCC |
| InChI | InChI=1S/C20H36O4.2C4H9.Sn/c1-3-5-7-9-11-13-15-17(19(21)22)18(20(23)24)16-14-12-10-8-6-4-2;2*1-3-4-2;/h3-16H2,1-2H3,(H,21,22)(H,23,24);2*1,3-4H2,2H3;/q;;;+2/p-2/b18-17-;;; |
| InChIKey | NPIPHAWEFUEGCP-IJRZPAASSA-L |
| XLogP | 6.41 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.43 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|