C20H36O4Sn — CID 159527383
dibutyltin(2+);(Z)-2-octylbut-2-enedioate (PubChem CID 159527383) has the molecular formula C20H36O4Sn and a molecular weight of 459.22 g/mol. Its IUPAC name is dibutyltin(2+);(Z)-2-octylbut-2-enedioate.
| Compound Name | dibutyltin(2+);(Z)-2-octylbut-2-enedioate |
|---|---|
| PubChem CID | 159527383 |
| Molecular Formula | C20H36O4Sn |
| Molecular Weight | 459.22 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | dibutyltin(2+);(Z)-2-octylbut-2-enedioate |
| SMILES | CCCCCCCC/C(=C/C(=O)[O-])C(=O)[O-].CCCC[Sn+2]CCCC |
| InChI | InChI=1S/C12H20O4.2C4H9.Sn/c1-2-3-4-5-6-7-8-10(12(15)16)9-11(13)14;2*1-3-4-2;/h9H,2-8H2,1H3,(H,13,14)(H,15,16);2*1,3-4H2,2H3;/q;;;+2/p-2/b10-9-;;; |
| InChIKey | MCOBUBXZKXKFSQ-BZKIHGKGSA-L |
| XLogP | 3.29 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|