C32H44O4Sn — CID 22463119
(Z)-2,3-dioctylbut-2-enedioate;diphenyltin(2+) (PubChem CID 22463119) has the molecular formula C32H44O4Sn and a molecular weight of 611.41 g/mol. Its IUPAC name is (Z)-2,3-dioctylbut-2-enedioate;diphenyltin(2+).
| Compound Name | (Z)-2,3-dioctylbut-2-enedioate;diphenyltin(2+) |
|---|---|
| PubChem CID | 22463119 |
| Molecular Formula | C32H44O4Sn |
| Molecular Weight | 611.41 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | (Z)-2,3-dioctylbut-2-enedioate;diphenyltin(2+) |
| SMILES | CCCCCCCC/C(C(=O)[O-])=C(\CCCCCCCC)C(=O)[O-].c1ccc([Sn+2]c2ccccc2)cc1 |
| InChI | InChI=1S/C20H36O4.2C6H5.Sn/c1-3-5-7-9-11-13-15-17(19(21)22)18(20(23)24)16-14-12-10-8-6-4-2;2*1-2-4-6-5-3-1;/h3-16H2,1-2H3,(H,21,22)(H,23,24);2*1-5H;/q;;;+2/p-2/b18-17-;;; |
| InChIKey | WDHFTXQGVYXFMQ-IJRZPAASSA-L |
| XLogP | 4.63 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|