About decanoate;phenylmercury(1+)
decanoate;phenylmercury(1+) (PubChem CID 70457724) has the molecular formula C16H24HgO2
and a molecular weight of 448.96 g/mol. Its IUPAC name is decanoate;phenylmercury(1+).
Molecular Properties
| Compound Name | decanoate;phenylmercury(1+) |
| PubChem CID | 70457724 |
| Molecular Formula | C16H24HgO2 |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | decanoate;phenylmercury(1+) |
| SMILES | CCCCCCCCCC(=O)[O-].[Hg+]c1ccccc1 |
| InChI | InChI=1S/C10H20O2.C6H5.Hg/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-4-6-5-3-1;/h2-9H2,1H3,(H,11,12);1-5H;/q;;+1/p-1 |
| InChIKey | KXVQQQJXIAJAGZ-UHFFFAOYSA-M |
| XLogP | 2.74 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze decanoate;phenylmercury(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanoate;phenylmercury(1+)?
The IUPAC name of decanoate;phenylmercury(1+) (CID 70457724) is decanoate;phenylmercury(1+).
What is the SMILES notation for decanoate;phenylmercury(1+)?
The canonical SMILES for decanoate;phenylmercury(1+) is CCCCCCCCCC(=O)[O-].[Hg+]c1ccccc1.
What is the InChIKey of decanoate;phenylmercury(1+)?
The InChIKey is KXVQQQJXIAJAGZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20O2.C6H5.Hg/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-4-6-5-3-1;/h2-9H2,1H3,(H,11,12);1-5H;/q;;+1/p-1.
What are the key properties of decanoate;phenylmercury(1+)?
decanoate;phenylmercury(1+) has a molecular weight of 448.96 g/mol, XLogP of 2.74, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decanoate;phenylmercury(1+) is sourced from PubChem (CID 70457724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).