About phenylazanium;undecanoate
phenylazanium;undecanoate (PubChem CID 139301589) has the molecular formula C17H29NO2
and a molecular weight of 279.42 g/mol. Its IUPAC name is phenylazanium;undecanoate.
Molecular Properties
| Compound Name | phenylazanium;undecanoate |
| PubChem CID | 139301589 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | phenylazanium;undecanoate |
| SMILES | CCCCCCCCCCC(=O)[O-].[NH3+]c1ccccc1 |
| InChI | InChI=1S/C11H22O2.C6H7N/c1-2-3-4-5-6-7-8-9-10-11(12)13;7-6-4-2-1-3-5-6/h2-10H2,1H3,(H,12,13);1-5H,7H2 |
| InChIKey | VAOGBNNDQZDDNP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze phenylazanium;undecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylazanium;undecanoate?
The IUPAC name of phenylazanium;undecanoate (CID 139301589) is phenylazanium;undecanoate.
What is the SMILES notation for phenylazanium;undecanoate?
The canonical SMILES for phenylazanium;undecanoate is CCCCCCCCCCC(=O)[O-].[NH3+]c1ccccc1.
What is the InChIKey of phenylazanium;undecanoate?
The InChIKey is VAOGBNNDQZDDNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2.C6H7N/c1-2-3-4-5-6-7-8-9-10-11(12)13;7-6-4-2-1-3-5-6/h2-10H2,1H3,(H,12,13);1-5H,7H2.
What are the key properties of phenylazanium;undecanoate?
phenylazanium;undecanoate has a molecular weight of 279.42 g/mol, XLogP of 2.83, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylazanium;undecanoate is sourced from PubChem (CID 139301589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).