About aminoazanium;decanoate
aminoazanium;decanoate (PubChem CID 158292126) has the molecular formula C10H24N2O2
and a molecular weight of 204.31 g/mol. Its IUPAC name is aminoazanium;decanoate.
Molecular Properties
| Compound Name | aminoazanium;decanoate |
| PubChem CID | 158292126 |
| Molecular Formula | C10H24N2O2 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.18 |
| IUPAC Name | aminoazanium;decanoate |
| SMILES | CCCCCCCCCC(=O)[O-].N[NH3+] |
| InChI | InChI=1S/C10H20O2.H4N2/c1-2-3-4-5-6-7-8-9-10(11)12;1-2/h2-9H2,1H3,(H,11,12);1-2H2 |
| InChIKey | GLMCYANHNSNDSL-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aminoazanium;decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminoazanium;decanoate?
The IUPAC name of aminoazanium;decanoate (CID 158292126) is aminoazanium;decanoate.
What is the SMILES notation for aminoazanium;decanoate?
The canonical SMILES for aminoazanium;decanoate is CCCCCCCCCC(=O)[O-].N[NH3+].
What is the InChIKey of aminoazanium;decanoate?
The InChIKey is GLMCYANHNSNDSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.H4N2/c1-2-3-4-5-6-7-8-9-10(11)12;1-2/h2-9H2,1H3,(H,11,12);1-2H2.
What are the key properties of aminoazanium;decanoate?
aminoazanium;decanoate has a molecular weight of 204.31 g/mol, XLogP of -0.02, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aminoazanium;decanoate is sourced from PubChem (CID 158292126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).