About aminoazanium;octadecanoate
aminoazanium;octadecanoate (PubChem CID 161398696) has the molecular formula C18H40N2O2
and a molecular weight of 316.53 g/mol. Its IUPAC name is aminoazanium;octadecanoate.
Molecular Properties
| Compound Name | aminoazanium;octadecanoate |
| PubChem CID | 161398696 |
| Molecular Formula | C18H40N2O2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | aminoazanium;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].N[NH3+] |
| InChI | InChI=1S/C18H36O2.H4N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2/h2-17H2,1H3,(H,19,20);1-2H2 |
| InChIKey | VTYFBEUGCXDTQK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aminoazanium;octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminoazanium;octadecanoate?
The IUPAC name of aminoazanium;octadecanoate (CID 161398696) is aminoazanium;octadecanoate.
What is the SMILES notation for aminoazanium;octadecanoate?
The canonical SMILES for aminoazanium;octadecanoate is CCCCCCCCCCCCCCCCCC(=O)[O-].N[NH3+].
What is the InChIKey of aminoazanium;octadecanoate?
The InChIKey is VTYFBEUGCXDTQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.H4N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2/h2-17H2,1H3,(H,19,20);1-2H2.
What are the key properties of aminoazanium;octadecanoate?
aminoazanium;octadecanoate has a molecular weight of 316.53 g/mol, XLogP of 3.10, 16 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aminoazanium;octadecanoate is sourced from PubChem (CID 161398696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).