About pentanoate;phenylazanium
pentanoate;phenylazanium (PubChem CID 139301604) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is pentanoate;phenylazanium.
Molecular Properties
| Compound Name | pentanoate;phenylazanium |
| PubChem CID | 139301604 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | pentanoate;phenylazanium |
| SMILES | CCCCC(=O)[O-].[NH3+]c1ccccc1 |
| InChI | InChI=1S/C6H7N.C5H10O2/c7-6-4-2-1-3-5-6;1-2-3-4-5(6)7/h1-5H,7H2;2-4H2,1H3,(H,6,7) |
| InChIKey | RQIORBRQPBHOLZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pentanoate;phenylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanoate;phenylazanium?
The IUPAC name of pentanoate;phenylazanium (CID 139301604) is pentanoate;phenylazanium.
What is the SMILES notation for pentanoate;phenylazanium?
The canonical SMILES for pentanoate;phenylazanium is CCCCC(=O)[O-].[NH3+]c1ccccc1.
What is the InChIKey of pentanoate;phenylazanium?
The InChIKey is RQIORBRQPBHOLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N.C5H10O2/c7-6-4-2-1-3-5-6;1-2-3-4-5(6)7/h1-5H,7H2;2-4H2,1H3,(H,6,7).
What are the key properties of pentanoate;phenylazanium?
pentanoate;phenylazanium has a molecular weight of 195.26 g/mol, XLogP of 0.49, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentanoate;phenylazanium is sourced from PubChem (CID 139301604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).