About pentanoate;triphenylazanium
pentanoate;triphenylazanium (PubChem CID 139301485) has the molecular formula C23H25NO2
and a molecular weight of 347.46 g/mol. Its IUPAC name is pentanoate;triphenylazanium.
Molecular Properties
| Compound Name | pentanoate;triphenylazanium |
| PubChem CID | 139301485 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | pentanoate;triphenylazanium |
| SMILES | CCCCC(=O)[O-].c1ccc([NH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N.C5H10O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-4-5(6)7/h1-15H;2-4H2,1H3,(H,6,7) |
| InChIKey | KPGJTDQXTNQLBE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pentanoate;triphenylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanoate;triphenylazanium?
The IUPAC name of pentanoate;triphenylazanium (CID 139301485) is pentanoate;triphenylazanium.
What is the SMILES notation for pentanoate;triphenylazanium?
The canonical SMILES for pentanoate;triphenylazanium is CCCCC(=O)[O-].c1ccc([NH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of pentanoate;triphenylazanium?
The InChIKey is KPGJTDQXTNQLBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N.C5H10O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-4-5(6)7/h1-15H;2-4H2,1H3,(H,6,7).
What are the key properties of pentanoate;triphenylazanium?
pentanoate;triphenylazanium has a molecular weight of 347.46 g/mol, XLogP of 3.79, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentanoate;triphenylazanium is sourced from PubChem (CID 139301485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).