About hexanoate;triphenylazanium
hexanoate;triphenylazanium (PubChem CID 139301475) has the molecular formula C24H27NO2
and a molecular weight of 361.49 g/mol. Its IUPAC name is hexanoate;triphenylazanium.
Molecular Properties
| Compound Name | hexanoate;triphenylazanium |
| PubChem CID | 139301475 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | hexanoate;triphenylazanium |
| SMILES | CCCCCC(=O)[O-].c1ccc([NH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N.C6H12O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-4-5-6(7)8/h1-15H;2-5H2,1H3,(H,7,8) |
| InChIKey | PCERWWZBDUSDQY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanoate;triphenylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanoate;triphenylazanium?
The IUPAC name of hexanoate;triphenylazanium (CID 139301475) is hexanoate;triphenylazanium.
What is the SMILES notation for hexanoate;triphenylazanium?
The canonical SMILES for hexanoate;triphenylazanium is CCCCCC(=O)[O-].c1ccc([NH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of hexanoate;triphenylazanium?
The InChIKey is PCERWWZBDUSDQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N.C6H12O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-4-5-6(7)8/h1-15H;2-5H2,1H3,(H,7,8).
What are the key properties of hexanoate;triphenylazanium?
hexanoate;triphenylazanium has a molecular weight of 361.49 g/mol, XLogP of 4.18, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexanoate;triphenylazanium is sourced from PubChem (CID 139301475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).