About sodium;benzenesulfonic acid;nonanoate
sodium;benzenesulfonic acid;nonanoate (PubChem CID 175280756) has the molecular formula C15H23NaO5S
and a molecular weight of 338.40 g/mol. Its IUPAC name is sodium;benzenesulfonic acid;nonanoate.
Molecular Properties
| Compound Name | sodium;benzenesulfonic acid;nonanoate |
| PubChem CID | 175280756 |
| Molecular Formula | C15H23NaO5S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | sodium;benzenesulfonic acid;nonanoate |
| SMILES | CCCCCCCCC(=O)[O-].O=S(=O)(O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C9H18O2.C6H6O3S.Na/c1-2-3-4-5-6-7-8-9(10)11;7-10(8,9)6-4-2-1-3-5-6;/h2-8H2,1H3,(H,10,11);1-5H,(H,7,8,9);/q;;+1/p-1 |
| InChIKey | UOSYMJNFNOYTIE-UHFFFAOYSA-M |
| XLogP | -0.58 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzenesulfonic acid;nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzenesulfonic acid;nonanoate?
The IUPAC name of sodium;benzenesulfonic acid;nonanoate (CID 175280756) is sodium;benzenesulfonic acid;nonanoate.
What is the SMILES notation for sodium;benzenesulfonic acid;nonanoate?
The canonical SMILES for sodium;benzenesulfonic acid;nonanoate is CCCCCCCCC(=O)[O-].O=S(=O)(O)c1ccccc1.[Na+].
What is the InChIKey of sodium;benzenesulfonic acid;nonanoate?
The InChIKey is UOSYMJNFNOYTIE-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18O2.C6H6O3S.Na/c1-2-3-4-5-6-7-8-9(10)11;7-10(8,9)6-4-2-1-3-5-6;/h2-8H2,1H3,(H,10,11);1-5H,(H,7,8,9);/q;;+1/p-1.
What are the key properties of sodium;benzenesulfonic acid;nonanoate?
sodium;benzenesulfonic acid;nonanoate has a molecular weight of 338.40 g/mol, XLogP of -0.58, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzenesulfonic acid;nonanoate is sourced from PubChem (CID 175280756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).