About methylazanium;pentanoate
methylazanium;pentanoate (PubChem CID 87904000) has the molecular formula C6H15NO2
and a molecular weight of 133.19 g/mol. Its IUPAC name is methylazanium;pentanoate.
Molecular Properties
| Compound Name | methylazanium;pentanoate |
| PubChem CID | 87904000 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | methylazanium;pentanoate |
| SMILES | CCCCC(=O)[O-].C[NH3+] |
| InChI | InChI=1S/C5H10O2.CH5N/c1-2-3-4-5(6)7;1-2/h2-4H2,1H3,(H,6,7);2H2,1H3 |
| InChIKey | BCIONRHKNKQXEY-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methylazanium;pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylazanium;pentanoate?
The IUPAC name of methylazanium;pentanoate (CID 87904000) is methylazanium;pentanoate.
What is the SMILES notation for methylazanium;pentanoate?
The canonical SMILES for methylazanium;pentanoate is CCCCC(=O)[O-].C[NH3+].
What is the InChIKey of methylazanium;pentanoate?
The InChIKey is BCIONRHKNKQXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.CH5N/c1-2-3-4-5(6)7;1-2/h2-4H2,1H3,(H,6,7);2H2,1H3.
What are the key properties of methylazanium;pentanoate?
methylazanium;pentanoate has a molecular weight of 133.19 g/mol, XLogP of -1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylazanium;pentanoate is sourced from PubChem (CID 87904000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).