About 4-oxopentanoate;pentanoate
4-oxopentanoate;pentanoate (PubChem CID 21431295) has the molecular formula C10H16O5-2
and a molecular weight of 216.23 g/mol. Its IUPAC name is 4-oxopentanoate;pentanoate.
Molecular Properties
| Compound Name | 4-oxopentanoate;pentanoate |
| PubChem CID | 21431295 |
| Molecular Formula | C10H16O5-2 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 4-oxopentanoate;pentanoate |
| SMILES | CC(=O)CCC(=O)[O-].CCCCC(=O)[O-] |
| InChI | InChI=1S/C5H8O3.C5H10O2/c1-4(6)2-3-5(7)8;1-2-3-4-5(6)7/h2-3H2,1H3,(H,7,8);2-4H2,1H3,(H,6,7)/p-2 |
| InChIKey | YMRWSLPLQNNKLB-UHFFFAOYSA-L |
| XLogP | -0.97 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-oxopentanoate;pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopentanoate;pentanoate?
The IUPAC name of 4-oxopentanoate;pentanoate (CID 21431295) is 4-oxopentanoate;pentanoate.
What is the SMILES notation for 4-oxopentanoate;pentanoate?
The canonical SMILES for 4-oxopentanoate;pentanoate is CC(=O)CCC(=O)[O-].CCCCC(=O)[O-].
What is the InChIKey of 4-oxopentanoate;pentanoate?
The InChIKey is YMRWSLPLQNNKLB-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H8O3.C5H10O2/c1-4(6)2-3-5(7)8;1-2-3-4-5(6)7/h2-3H2,1H3,(H,7,8);2-4H2,1H3,(H,6,7)/p-2.
What are the key properties of 4-oxopentanoate;pentanoate?
4-oxopentanoate;pentanoate has a molecular weight of 216.23 g/mol, XLogP of -0.97, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopentanoate;pentanoate is sourced from PubChem (CID 21431295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).