About diethyl(methyl)azanium;pentanoate
diethyl(methyl)azanium;pentanoate (PubChem CID 87523267) has the molecular formula C10H23NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is diethyl(methyl)azanium;pentanoate.
Molecular Properties
| Compound Name | diethyl(methyl)azanium;pentanoate |
| PubChem CID | 87523267 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | diethyl(methyl)azanium;pentanoate |
| SMILES | CCCCC(=O)[O-].CC[NH+](C)CC |
| InChI | InChI=1S/C5H13N.C5H10O2/c1-4-6(3)5-2;1-2-3-4-5(6)7/h4-5H2,1-3H3;2-4H2,1H3,(H,6,7) |
| InChIKey | KLOXGWBBAFZOGM-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diethyl(methyl)azanium;pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl(methyl)azanium;pentanoate?
The IUPAC name of diethyl(methyl)azanium;pentanoate (CID 87523267) is diethyl(methyl)azanium;pentanoate.
What is the SMILES notation for diethyl(methyl)azanium;pentanoate?
The canonical SMILES for diethyl(methyl)azanium;pentanoate is CCCCC(=O)[O-].CC[NH+](C)CC.
What is the InChIKey of diethyl(methyl)azanium;pentanoate?
The InChIKey is KLOXGWBBAFZOGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N.C5H10O2/c1-4-6(3)5-2;1-2-3-4-5(6)7/h4-5H2,1-3H3;2-4H2,1H3,(H,6,7).
What are the key properties of diethyl(methyl)azanium;pentanoate?
diethyl(methyl)azanium;pentanoate has a molecular weight of 189.30 g/mol, XLogP of -0.53, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(methyl)azanium;pentanoate is sourced from PubChem (CID 87523267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).