About ethyl-methyl-tetradecylazanium;octadecanoate
ethyl-methyl-tetradecylazanium;octadecanoate (PubChem CID 134501498) has the molecular formula C35H73NO2
and a molecular weight of 539.97 g/mol. Its IUPAC name is ethyl-methyl-tetradecylazanium;octadecanoate.
Molecular Properties
| Compound Name | ethyl-methyl-tetradecylazanium;octadecanoate |
| PubChem CID | 134501498 |
| Molecular Formula | C35H73NO2 |
| Molecular Weight | 539.97 g/mol |
| Exact Mass | 539.56 |
| IUPAC Name | ethyl-methyl-tetradecylazanium;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCC[NH+](C)CC |
| InChI | InChI=1S/C18H36O2.C17H37N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-6-7-8-9-10-11-12-13-14-15-16-17-18(3)5-2/h2-17H2,1H3,(H,19,20);4-17H2,1-3H3 |
| InChIKey | NXVZYWCEIXZNQV-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.97 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl-methyl-tetradecylazanium;octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-methyl-tetradecylazanium;octadecanoate?
The IUPAC name of ethyl-methyl-tetradecylazanium;octadecanoate (CID 134501498) is ethyl-methyl-tetradecylazanium;octadecanoate.
What is the SMILES notation for ethyl-methyl-tetradecylazanium;octadecanoate?
The canonical SMILES for ethyl-methyl-tetradecylazanium;octadecanoate is CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCC[NH+](C)CC.
What is the InChIKey of ethyl-methyl-tetradecylazanium;octadecanoate?
The InChIKey is NXVZYWCEIXZNQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C17H37N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-6-7-8-9-10-11-12-13-14-15-16-17-18(3)5-2/h2-17H2,1H3,(H,19,20);4-17H2,1-3H3.
What are the key properties of ethyl-methyl-tetradecylazanium;octadecanoate?
ethyl-methyl-tetradecylazanium;octadecanoate has a molecular weight of 539.97 g/mol, XLogP of 9.22, 30 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-methyl-tetradecylazanium;octadecanoate is sourced from PubChem (CID 134501498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).