About decyl(dimethyl)azanium;hexanoate
decyl(dimethyl)azanium;hexanoate (PubChem CID 87523798) has the molecular formula C18H39NO2
and a molecular weight of 301.52 g/mol. Its IUPAC name is decyl(dimethyl)azanium;hexanoate.
Molecular Properties
| Compound Name | decyl(dimethyl)azanium;hexanoate |
| PubChem CID | 87523798 |
| Molecular Formula | C18H39NO2 |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.30 |
| IUPAC Name | decyl(dimethyl)azanium;hexanoate |
| SMILES | CCCCCC(=O)[O-].CCCCCCCCCC[NH+](C)C |
| InChI | InChI=1S/C12H27N.C6H12O2/c1-4-5-6-7-8-9-10-11-12-13(2)3;1-2-3-4-5-6(7)8/h4-12H2,1-3H3;2-5H2,1H3,(H,7,8) |
| InChIKey | YREHVVICBQQSBJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decyl(dimethyl)azanium;hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl(dimethyl)azanium;hexanoate?
The IUPAC name of decyl(dimethyl)azanium;hexanoate (CID 87523798) is decyl(dimethyl)azanium;hexanoate.
What is the SMILES notation for decyl(dimethyl)azanium;hexanoate?
The canonical SMILES for decyl(dimethyl)azanium;hexanoate is CCCCCC(=O)[O-].CCCCCCCCCC[NH+](C)C.
What is the InChIKey of decyl(dimethyl)azanium;hexanoate?
The InChIKey is YREHVVICBQQSBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.C6H12O2/c1-4-5-6-7-8-9-10-11-12-13(2)3;1-2-3-4-5-6(7)8/h4-12H2,1-3H3;2-5H2,1H3,(H,7,8).
What are the key properties of decyl(dimethyl)azanium;hexanoate?
decyl(dimethyl)azanium;hexanoate has a molecular weight of 301.52 g/mol, XLogP of 2.59, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decyl(dimethyl)azanium;hexanoate is sourced from PubChem (CID 87523798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).