About dimethyl(octadecyl)azanium;hexadecanoate
dimethyl(octadecyl)azanium;hexadecanoate (PubChem CID 21223193) has the molecular formula C36H75NO2
and a molecular weight of 554.00 g/mol. Its IUPAC name is dimethyl(octadecyl)azanium;hexadecanoate.
Molecular Properties
| Compound Name | dimethyl(octadecyl)azanium;hexadecanoate |
| PubChem CID | 21223193 |
| Molecular Formula | C36H75NO2 |
| Molecular Weight | 554.00 g/mol |
| Exact Mass | 553.58 |
| IUPAC Name | dimethyl(octadecyl)azanium;hexadecanoate |
| SMILES | CCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCCCC[NH+](C)C |
| InChI | InChI=1S/C20H43N.C16H32O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h4-20H2,1-3H3;2-15H2,1H3,(H,17,18) |
| InChIKey | GIFASMIJBHVQRZ-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.00 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(octadecyl)azanium;hexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(octadecyl)azanium;hexadecanoate?
The IUPAC name of dimethyl(octadecyl)azanium;hexadecanoate (CID 21223193) is dimethyl(octadecyl)azanium;hexadecanoate.
What is the SMILES notation for dimethyl(octadecyl)azanium;hexadecanoate?
The canonical SMILES for dimethyl(octadecyl)azanium;hexadecanoate is CCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCCCC[NH+](C)C.
What is the InChIKey of dimethyl(octadecyl)azanium;hexadecanoate?
The InChIKey is GIFASMIJBHVQRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43N.C16H32O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h4-20H2,1-3H3;2-15H2,1H3,(H,17,18).
What are the key properties of dimethyl(octadecyl)azanium;hexadecanoate?
dimethyl(octadecyl)azanium;hexadecanoate has a molecular weight of 554.00 g/mol, XLogP of 9.61, 31 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(octadecyl)azanium;hexadecanoate is sourced from PubChem (CID 21223193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).