About 2-hydroxyethyl(dimethyl)azanium;octanoate
2-hydroxyethyl(dimethyl)azanium;octanoate (PubChem CID 57346607) has the molecular formula C12H27NO3
and a molecular weight of 233.35 g/mol. Its IUPAC name is 2-hydroxyethyl(dimethyl)azanium;octanoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl(dimethyl)azanium;octanoate |
| PubChem CID | 57346607 |
| Molecular Formula | C12H27NO3 |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | 2-hydroxyethyl(dimethyl)azanium;octanoate |
| SMILES | CCCCCCCC(=O)[O-].C[NH+](C)CCO |
| InChI | InChI=1S/C8H16O2.C4H11NO/c1-2-3-4-5-6-7-8(9)10;1-5(2)3-4-6/h2-7H2,1H3,(H,9,10);6H,3-4H2,1-2H3 |
| InChIKey | VNUYQPMOYYTIKV-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 64.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl(dimethyl)azanium;octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl(dimethyl)azanium;octanoate?
The IUPAC name of 2-hydroxyethyl(dimethyl)azanium;octanoate (CID 57346607) is 2-hydroxyethyl(dimethyl)azanium;octanoate.
What is the SMILES notation for 2-hydroxyethyl(dimethyl)azanium;octanoate?
The canonical SMILES for 2-hydroxyethyl(dimethyl)azanium;octanoate is CCCCCCCC(=O)[O-].C[NH+](C)CCO.
What is the InChIKey of 2-hydroxyethyl(dimethyl)azanium;octanoate?
The InChIKey is VNUYQPMOYYTIKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C4H11NO/c1-2-3-4-5-6-7-8(9)10;1-5(2)3-4-6/h2-7H2,1H3,(H,9,10);6H,3-4H2,1-2H3.
What are the key properties of 2-hydroxyethyl(dimethyl)azanium;octanoate?
2-hydroxyethyl(dimethyl)azanium;octanoate has a molecular weight of 233.35 g/mol, XLogP of -0.78, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl(dimethyl)azanium;octanoate is sourced from PubChem (CID 57346607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).