About tris(2-hydroxyethyl)azanium;undecanoate
tris(2-hydroxyethyl)azanium;undecanoate (PubChem CID 142313792) has the molecular formula C17H37NO5
and a molecular weight of 335.49 g/mol. Its IUPAC name is tris(2-hydroxyethyl)azanium;undecanoate.
Molecular Properties
| Compound Name | tris(2-hydroxyethyl)azanium;undecanoate |
| PubChem CID | 142313792 |
| Molecular Formula | C17H37NO5 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.27 |
| IUPAC Name | tris(2-hydroxyethyl)azanium;undecanoate |
| SMILES | CCCCCCCCCCC(=O)[O-].OCC[NH+](CCO)CCO |
| InChI | InChI=1S/C11H22O2.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11(12)13;8-4-1-7(2-5-9)3-6-10/h2-10H2,1H3,(H,12,13);8-10H,1-6H2 |
| InChIKey | YUGQAXMSFXLTRQ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tris(2-hydroxyethyl)azanium;undecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-hydroxyethyl)azanium;undecanoate?
The IUPAC name of tris(2-hydroxyethyl)azanium;undecanoate (CID 142313792) is tris(2-hydroxyethyl)azanium;undecanoate.
What is the SMILES notation for tris(2-hydroxyethyl)azanium;undecanoate?
The canonical SMILES for tris(2-hydroxyethyl)azanium;undecanoate is CCCCCCCCCCC(=O)[O-].OCC[NH+](CCO)CCO.
What is the InChIKey of tris(2-hydroxyethyl)azanium;undecanoate?
The InChIKey is YUGQAXMSFXLTRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11(12)13;8-4-1-7(2-5-9)3-6-10/h2-10H2,1H3,(H,12,13);8-10H,1-6H2.
What are the key properties of tris(2-hydroxyethyl)azanium;undecanoate?
tris(2-hydroxyethyl)azanium;undecanoate has a molecular weight of 335.49 g/mol, XLogP of -0.88, 15 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-hydroxyethyl)azanium;undecanoate is sourced from PubChem (CID 142313792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).