About dodecanoate;tripropylazanium
dodecanoate;tripropylazanium (PubChem CID 139301601) has the molecular formula C21H45NO2
and a molecular weight of 343.60 g/mol. Its IUPAC name is dodecanoate;tripropylazanium.
Molecular Properties
| Compound Name | dodecanoate;tripropylazanium |
| PubChem CID | 139301601 |
| Molecular Formula | C21H45NO2 |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 343.35 |
| IUPAC Name | dodecanoate;tripropylazanium |
| SMILES | CCCCCCCCCCCC(=O)[O-].CCC[NH+](CCC)CCC |
| InChI | InChI=1S/C12H24O2.C9H21N/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-4-7-10(8-5-2)9-6-3/h2-11H2,1H3,(H,13,14);4-9H2,1-3H3 |
| InChIKey | AMPJFNQLTZPERR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecanoate;tripropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecanoate;tripropylazanium?
The IUPAC name of dodecanoate;tripropylazanium (CID 139301601) is dodecanoate;tripropylazanium.
What is the SMILES notation for dodecanoate;tripropylazanium?
The canonical SMILES for dodecanoate;tripropylazanium is CCCCCCCCCCCC(=O)[O-].CCC[NH+](CCC)CCC.
What is the InChIKey of dodecanoate;tripropylazanium?
The InChIKey is AMPJFNQLTZPERR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.C9H21N/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-4-7-10(8-5-2)9-6-3/h2-11H2,1H3,(H,13,14);4-9H2,1-3H3.
What are the key properties of dodecanoate;tripropylazanium?
dodecanoate;tripropylazanium has a molecular weight of 343.60 g/mol, XLogP of 3.76, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodecanoate;tripropylazanium is sourced from PubChem (CID 139301601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).