About octadecanoate dihydroxide
octadecanoate dihydroxide (PubChem CID 22409007) has the molecular formula C18H37O4-3
and a molecular weight of 317.49 g/mol. Its IUPAC name is octadecanoate dihydroxide.
Molecular Properties
| Compound Name | octadecanoate dihydroxide |
| PubChem CID | 22409007 |
| Molecular Formula | C18H37O4-3 |
| Molecular Weight | 317.49 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | octadecanoate dihydroxide |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].[OH-].[OH-] |
| InChI | InChI=1S/C18H36O2.2H2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;;/h2-17H2,1H3,(H,19,20);2*1H2/p-3 |
| InChIKey | OUOPFMMIKLEKSS-UHFFFAOYSA-K |
| XLogP | 4.64 |
| TPSA | 100.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecanoate dihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecanoate dihydroxide?
The IUPAC name of octadecanoate dihydroxide (CID 22409007) is octadecanoate dihydroxide.
What is the SMILES notation for octadecanoate dihydroxide?
The canonical SMILES for octadecanoate dihydroxide is CCCCCCCCCCCCCCCCCC(=O)[O-].[OH-].[OH-].
What is the InChIKey of octadecanoate dihydroxide?
The InChIKey is OUOPFMMIKLEKSS-UHFFFAOYSA-K. The full InChI is InChI=1S/C18H36O2.2H2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;;/h2-17H2,1H3,(H,19,20);2*1H2/p-3.
What are the key properties of octadecanoate dihydroxide?
octadecanoate dihydroxide has a molecular weight of 317.49 g/mol, XLogP of 4.64, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for octadecanoate dihydroxide is sourced from PubChem (CID 22409007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).