About bis(chromium(3+));tetradecanoate;pentahydroxide
bis(chromium(3+));tetradecanoate;pentahydroxide (PubChem CID 138394583) has the molecular formula C14H32Cr2O7
and a molecular weight of 416.40 g/mol. Its IUPAC name is bis(chromium(3+));tetradecanoate;pentahydroxide.
Molecular Properties
| Compound Name | bis(chromium(3+));tetradecanoate;pentahydroxide |
| PubChem CID | 138394583 |
| Molecular Formula | C14H32Cr2O7 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | bis(chromium(3+));tetradecanoate;pentahydroxide |
| SMILES | CCCCCCCCCCCCCC(=O)[O-].[Cr+3].[Cr+3].[OH-].[OH-].[OH-].[OH-].[OH-] |
| InChI | InChI=1S/C14H28O2.2Cr.5H2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;;;;;;;/h2-13H2,1H3,(H,15,16);;;5*1H2/q;2*+3;;;;;/p-6 |
| InChIKey | ILAUTXSTNQQRMJ-UHFFFAOYSA-H |
| XLogP | 2.55 |
| TPSA | 190.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(chromium(3+));tetradecanoate;pentahydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(chromium(3+));tetradecanoate;pentahydroxide?
The IUPAC name of bis(chromium(3+));tetradecanoate;pentahydroxide (CID 138394583) is bis(chromium(3+));tetradecanoate;pentahydroxide.
What is the SMILES notation for bis(chromium(3+));tetradecanoate;pentahydroxide?
The canonical SMILES for bis(chromium(3+));tetradecanoate;pentahydroxide is CCCCCCCCCCCCCC(=O)[O-].[Cr+3].[Cr+3].[OH-].[OH-].[OH-].[OH-].[OH-].
What is the InChIKey of bis(chromium(3+));tetradecanoate;pentahydroxide?
The InChIKey is ILAUTXSTNQQRMJ-UHFFFAOYSA-H. The full InChI is InChI=1S/C14H28O2.2Cr.5H2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;;;;;;;/h2-13H2,1H3,(H,15,16);;;5*1H2/q;2*+3;;;;;/p-6.
What are the key properties of bis(chromium(3+));tetradecanoate;pentahydroxide?
bis(chromium(3+));tetradecanoate;pentahydroxide has a molecular weight of 416.40 g/mol, XLogP of 2.55, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(chromium(3+));tetradecanoate;pentahydroxide is sourced from PubChem (CID 138394583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).