About iron(2+);bis(nonanoate)
iron(2+);bis(nonanoate) (PubChem CID 90001894) has the molecular formula C18H34FeO4
and a molecular weight of 370.31 g/mol. Its IUPAC name is iron(2+);bis(nonanoate).
Molecular Properties
| Compound Name | iron(2+);bis(nonanoate) |
| PubChem CID | 90001894 |
| Molecular Formula | C18H34FeO4 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | iron(2+);bis(nonanoate) |
| SMILES | CCCCCCCCC(=O)[O-].CCCCCCCCC(=O)[O-].[Fe+2] |
| InChI | InChI=1S/2C9H18O2.Fe/c2*1-2-3-4-5-6-7-8-9(10)11;/h2*2-8H2,1H3,(H,10,11);/q;;+2/p-2 |
| InChIKey | UTCGLBIPYDLKNF-UHFFFAOYSA-L |
| XLogP | 2.97 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);bis(nonanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);bis(nonanoate)?
The IUPAC name of iron(2+);bis(nonanoate) (CID 90001894) is iron(2+);bis(nonanoate).
What is the SMILES notation for iron(2+);bis(nonanoate)?
The canonical SMILES for iron(2+);bis(nonanoate) is CCCCCCCCC(=O)[O-].CCCCCCCCC(=O)[O-].[Fe+2].
What is the InChIKey of iron(2+);bis(nonanoate)?
The InChIKey is UTCGLBIPYDLKNF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H18O2.Fe/c2*1-2-3-4-5-6-7-8-9(10)11;/h2*2-8H2,1H3,(H,10,11);/q;;+2/p-2.
What are the key properties of iron(2+);bis(nonanoate)?
iron(2+);bis(nonanoate) has a molecular weight of 370.31 g/mol, XLogP of 2.97, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);bis(nonanoate) is sourced from PubChem (CID 90001894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).