About bis(decanoate);iron(2+)
bis(decanoate);iron(2+) (PubChem CID 22404555) has the molecular formula C20H38FeO4
and a molecular weight of 398.37 g/mol. Its IUPAC name is bis(decanoate);iron(2+).
Molecular Properties
| Compound Name | bis(decanoate);iron(2+) |
| PubChem CID | 22404555 |
| Molecular Formula | C20H38FeO4 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | bis(decanoate);iron(2+) |
| SMILES | CCCCCCCCCC(=O)[O-].CCCCCCCCCC(=O)[O-].[Fe+2] |
| InChI | InChI=1S/2C10H20O2.Fe/c2*1-2-3-4-5-6-7-8-9-10(11)12;/h2*2-9H2,1H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | DSCHOXDNLZEJKS-UHFFFAOYSA-L |
| XLogP | 3.75 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(decanoate);iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(decanoate);iron(2+)?
The IUPAC name of bis(decanoate);iron(2+) (CID 22404555) is bis(decanoate);iron(2+).
What is the SMILES notation for bis(decanoate);iron(2+)?
The canonical SMILES for bis(decanoate);iron(2+) is CCCCCCCCCC(=O)[O-].CCCCCCCCCC(=O)[O-].[Fe+2].
What is the InChIKey of bis(decanoate);iron(2+)?
The InChIKey is DSCHOXDNLZEJKS-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H20O2.Fe/c2*1-2-3-4-5-6-7-8-9-10(11)12;/h2*2-9H2,1H3,(H,11,12);/q;;+2/p-2.
What are the key properties of bis(decanoate);iron(2+)?
bis(decanoate);iron(2+) has a molecular weight of 398.37 g/mol, XLogP of 3.75, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(decanoate);iron(2+) is sourced from PubChem (CID 22404555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).