About didecyl(methyl)azanium acetate
didecyl(methyl)azanium acetate (PubChem CID 122696251) has the molecular formula C23H49NO2
and a molecular weight of 371.65 g/mol. Its IUPAC name is didecyl(methyl)azanium acetate.
Molecular Properties
| Compound Name | didecyl(methyl)azanium acetate |
| PubChem CID | 122696251 |
| Molecular Formula | C23H49NO2 |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 371.38 |
| IUPAC Name | didecyl(methyl)azanium acetate |
| SMILES | CC(=O)[O-].CCCCCCCCCC[NH+](C)CCCCCCCCCC |
| InChI | InChI=1S/C21H45N.C2H4O2/c1-4-6-8-10-12-14-16-18-20-22(3)21-19-17-15-13-11-9-7-5-2;1-2(3)4/h4-21H2,1-3H3;1H3,(H,3,4) |
| InChIKey | ALLJCXIMYXEJFF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze didecyl(methyl)azanium acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecyl(methyl)azanium acetate?
The IUPAC name of didecyl(methyl)azanium acetate (CID 122696251) is didecyl(methyl)azanium acetate.
What is the SMILES notation for didecyl(methyl)azanium acetate?
The canonical SMILES for didecyl(methyl)azanium acetate is CC(=O)[O-].CCCCCCCCCC[NH+](C)CCCCCCCCCC.
What is the InChIKey of didecyl(methyl)azanium acetate?
The InChIKey is ALLJCXIMYXEJFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H45N.C2H4O2/c1-4-6-8-10-12-14-16-18-20-22(3)21-19-17-15-13-11-9-7-5-2;1-2(3)4/h4-21H2,1-3H3;1H3,(H,3,4).
What are the key properties of didecyl(methyl)azanium acetate?
didecyl(methyl)azanium acetate has a molecular weight of 371.65 g/mol, XLogP of 4.54, 18 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for didecyl(methyl)azanium acetate is sourced from PubChem (CID 122696251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).