About diphenyltin(2+);bis(octadec-9-enoate)
diphenyltin(2+);bis(octadec-9-enoate) (PubChem CID 159227048) has the molecular formula C48H76O4Sn
and a molecular weight of 835.84 g/mol. Its IUPAC name is diphenyltin(2+);bis(octadec-9-enoate).
Molecular Properties
| Compound Name | diphenyltin(2+);bis(octadec-9-enoate) |
| PubChem CID | 159227048 |
| Molecular Formula | C48H76O4Sn |
| Molecular Weight | 835.84 g/mol |
| Exact Mass | 836.48 |
| IUPAC Name | diphenyltin(2+);bis(octadec-9-enoate) |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)[O-].CCCCCCCCC=CCCCCCCCC(=O)[O-].c1ccc([Sn+2]c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H34O2.2C6H5.Sn/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2*1-2-4-6-5-3-1;/h2*9-10H,2-8,11-17H2,1H3,(H,19,20);2*1-5H;/q;;;;+2/p-2 |
| InChIKey | KSKOKDZZYAMGNS-UHFFFAOYSA-L |
| XLogP | 10.89 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 835.84 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diphenyltin(2+);bis(octadec-9-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyltin(2+);bis(octadec-9-enoate)?
The IUPAC name of diphenyltin(2+);bis(octadec-9-enoate) (CID 159227048) is diphenyltin(2+);bis(octadec-9-enoate).
What is the SMILES notation for diphenyltin(2+);bis(octadec-9-enoate)?
The canonical SMILES for diphenyltin(2+);bis(octadec-9-enoate) is CCCCCCCCC=CCCCCCCCC(=O)[O-].CCCCCCCCC=CCCCCCCCC(=O)[O-].c1ccc([Sn+2]c2ccccc2)cc1.
What is the InChIKey of diphenyltin(2+);bis(octadec-9-enoate)?
The InChIKey is KSKOKDZZYAMGNS-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H34O2.2C6H5.Sn/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2*1-2-4-6-5-3-1;/h2*9-10H,2-8,11-17H2,1H3,(H,19,20);2*1-5H;/q;;;;+2/p-2.
What are the key properties of diphenyltin(2+);bis(octadec-9-enoate)?
diphenyltin(2+);bis(octadec-9-enoate) has a molecular weight of 835.84 g/mol, XLogP of 10.89, 32 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyltin(2+);bis(octadec-9-enoate) is sourced from PubChem (CID 159227048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).