About dilithium;(Z)-octadec-9-enoate;benzoate
dilithium;(Z)-octadec-9-enoate;benzoate (PubChem CID 69380584) has the molecular formula C25H38Li2O4
and a molecular weight of 416.46 g/mol. Its IUPAC name is dilithium;(Z)-octadec-9-enoate;benzoate.
Molecular Properties
| Compound Name | dilithium;(Z)-octadec-9-enoate;benzoate |
| PubChem CID | 69380584 |
| Molecular Formula | C25H38Li2O4 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | dilithium;(Z)-octadec-9-enoate;benzoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)[O-].O=C([O-])c1ccccc1.[Li+].[Li+] |
| InChI | InChI=1S/C18H34O2.C7H6O2.2Li/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;8-7(9)6-4-2-1-3-5-6;;/h9-10H,2-8,11-17H2,1H3,(H,19,20);1-5H,(H,8,9);;/q;;2*+1/p-2/b10-9-;;; |
| InChIKey | RHPGCJNVDXYGND-BZKIHGKGSA-L |
| XLogP | -1.17 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dilithium;(Z)-octadec-9-enoate;benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;(Z)-octadec-9-enoate;benzoate?
The IUPAC name of dilithium;(Z)-octadec-9-enoate;benzoate (CID 69380584) is dilithium;(Z)-octadec-9-enoate;benzoate.
What is the SMILES notation for dilithium;(Z)-octadec-9-enoate;benzoate?
The canonical SMILES for dilithium;(Z)-octadec-9-enoate;benzoate is CCCCCCCC/C=C\CCCCCCCC(=O)[O-].O=C([O-])c1ccccc1.[Li+].[Li+].
What is the InChIKey of dilithium;(Z)-octadec-9-enoate;benzoate?
The InChIKey is RHPGCJNVDXYGND-BZKIHGKGSA-L. The full InChI is InChI=1S/C18H34O2.C7H6O2.2Li/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;8-7(9)6-4-2-1-3-5-6;;/h9-10H,2-8,11-17H2,1H3,(H,19,20);1-5H,(H,8,9);;/q;;2*+1/p-2/b10-9-;;;.
What are the key properties of dilithium;(Z)-octadec-9-enoate;benzoate?
dilithium;(Z)-octadec-9-enoate;benzoate has a molecular weight of 416.46 g/mol, XLogP of -1.17, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;(Z)-octadec-9-enoate;benzoate is sourced from PubChem (CID 69380584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).