C9H18O7S2 — CID 87776874
2-oxononane-1,1-disulfonic acid (PubChem CID 87776874) has the molecular formula C9H18O7S2 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-oxononane-1,1-disulfonic acid.
| Compound Name | 2-oxononane-1,1-disulfonic acid |
|---|---|
| PubChem CID | 87776874 |
| Molecular Formula | C9H18O7S2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-oxononane-1,1-disulfonic acid |
| SMILES | CCCCCCCC(=O)C(S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C9H18O7S2/c1-2-3-4-5-6-7-8(10)9(17(11,12)13)18(14,15)16/h9H,2-7H2,1H3,(H,11,12,13)(H,14,15,16) |
| InChIKey | MYECAYJOVDWCOC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|