About 2-methylhexadecan-3-one
2-methylhexadecan-3-one (PubChem CID 58030381) has the molecular formula C17H34O
and a molecular weight of 254.46 g/mol. Its IUPAC name is 2-methylhexadecan-3-one.
Molecular Properties
| Compound Name | 2-methylhexadecan-3-one |
| PubChem CID | 58030381 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 2-methylhexadecan-3-one |
| SMILES | CCCCCCCCCCCCCC(=O)C(C)C |
| InChI | InChI=1S/C17H34O/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(18)16(2)3/h16H,4-15H2,1-3H3 |
| InChIKey | LUAIPJGSGDNTMM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhexadecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexadecan-3-one?
The IUPAC name of 2-methylhexadecan-3-one (CID 58030381) is 2-methylhexadecan-3-one.
What is the SMILES notation for 2-methylhexadecan-3-one?
The canonical SMILES for 2-methylhexadecan-3-one is CCCCCCCCCCCCCC(=O)C(C)C.
What is the InChIKey of 2-methylhexadecan-3-one?
The InChIKey is LUAIPJGSGDNTMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(18)16(2)3/h16H,4-15H2,1-3H3.
What are the key properties of 2-methylhexadecan-3-one?
2-methylhexadecan-3-one has a molecular weight of 254.46 g/mol, XLogP of 5.91, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexadecan-3-one is sourced from PubChem (CID 58030381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).