About (3S)-2,3-dimethylnonadecan-4-one
(3S)-2,3-dimethylnonadecan-4-one (PubChem CID 174010260) has the molecular formula C21H42O
and a molecular weight of 310.57 g/mol. Its IUPAC name is (3S)-2,3-dimethylnonadecan-4-one.
Molecular Properties
| Compound Name | (3S)-2,3-dimethylnonadecan-4-one |
| PubChem CID | 174010260 |
| Molecular Formula | C21H42O |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.32 |
| IUPAC Name | (3S)-2,3-dimethylnonadecan-4-one |
| SMILES | CCCCCCCCCCCCCCCC(=O)[C@@H](C)C(C)C |
| InChI | InChI=1S/C21H42O/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(22)20(4)19(2)3/h19-20H,5-18H2,1-4H3/t20-/m0/s1 |
| InChIKey | XYMOVGXTYYCZEC-FQEVSTJZSA-N |
| XLogP | 7.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2,3-dimethylnonadecan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,3-dimethylnonadecan-4-one?
The IUPAC name of (3S)-2,3-dimethylnonadecan-4-one (CID 174010260) is (3S)-2,3-dimethylnonadecan-4-one.
What is the SMILES notation for (3S)-2,3-dimethylnonadecan-4-one?
The canonical SMILES for (3S)-2,3-dimethylnonadecan-4-one is CCCCCCCCCCCCCCCC(=O)[C@@H](C)C(C)C.
What is the InChIKey of (3S)-2,3-dimethylnonadecan-4-one?
The InChIKey is XYMOVGXTYYCZEC-FQEVSTJZSA-N. The full InChI is InChI=1S/C21H42O/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(22)20(4)19(2)3/h19-20H,5-18H2,1-4H3/t20-/m0/s1.
What are the key properties of (3S)-2,3-dimethylnonadecan-4-one?
(3S)-2,3-dimethylnonadecan-4-one has a molecular weight of 310.57 g/mol, XLogP of 7.33, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,3-dimethylnonadecan-4-one is sourced from PubChem (CID 174010260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).