C13H26O2 — CID 102467022
3-hydroxy-2,2,4-trimethyldecan-5-one (PubChem CID 102467022) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 3-hydroxy-2,2,4-trimethyldecan-5-one.
| Compound Name | 3-hydroxy-2,2,4-trimethyldecan-5-one |
|---|---|
| PubChem CID | 102467022 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 3-hydroxy-2,2,4-trimethyldecan-5-one |
| SMILES | CCCCCC(=O)C(C)C(O)C(C)(C)C |
| InChI | InChI=1S/C13H26O2/c1-6-7-8-9-11(14)10(2)12(15)13(3,4)5/h10,12,15H,6-9H2,1-5H3 |
| InChIKey | CNOGGSOCZANRBV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|