About 2-methyldodecane-3,5-dione
2-methyldodecane-3,5-dione (PubChem CID 62875134) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 2-methyldodecane-3,5-dione.
Molecular Properties
| Compound Name | 2-methyldodecane-3,5-dione |
| PubChem CID | 62875134 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2-methyldodecane-3,5-dione |
| SMILES | CCCCCCCC(=O)CC(=O)C(C)C |
| InChI | InChI=1S/C13H24O2/c1-4-5-6-7-8-9-12(14)10-13(15)11(2)3/h11H,4-10H2,1-3H3 |
| InChIKey | NJASAPXPNQBGNA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methyldodecane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyldodecane-3,5-dione?
The IUPAC name of 2-methyldodecane-3,5-dione (CID 62875134) is 2-methyldodecane-3,5-dione.
What is the SMILES notation for 2-methyldodecane-3,5-dione?
The canonical SMILES for 2-methyldodecane-3,5-dione is CCCCCCCC(=O)CC(=O)C(C)C.
What is the InChIKey of 2-methyldodecane-3,5-dione?
The InChIKey is NJASAPXPNQBGNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-4-5-6-7-8-9-12(14)10-13(15)11(2)3/h11H,4-10H2,1-3H3.
What are the key properties of 2-methyldodecane-3,5-dione?
2-methyldodecane-3,5-dione has a molecular weight of 212.33 g/mol, XLogP of 3.53, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyldodecane-3,5-dione is sourced from PubChem (CID 62875134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).