About 2-methylheptan-3-one;hydrate
2-methylheptan-3-one;hydrate (PubChem CID 176897102) has the molecular formula C8H18O2
and a molecular weight of 146.23 g/mol. Its IUPAC name is 2-methylheptan-3-one;hydrate.
Molecular Properties
| Compound Name | 2-methylheptan-3-one;hydrate |
| PubChem CID | 176897102 |
| Molecular Formula | C8H18O2 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | 2-methylheptan-3-one;hydrate |
| SMILES | CCCCC(=O)C(C)C.O |
| InChI | InChI=1S/C8H16O.H2O/c1-4-5-6-8(9)7(2)3;/h7H,4-6H2,1-3H3;1H2 |
| InChIKey | NWIAGLORZKWPFN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylheptan-3-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylheptan-3-one;hydrate?
The IUPAC name of 2-methylheptan-3-one;hydrate (CID 176897102) is 2-methylheptan-3-one;hydrate.
What is the SMILES notation for 2-methylheptan-3-one;hydrate?
The canonical SMILES for 2-methylheptan-3-one;hydrate is CCCCC(=O)C(C)C.O.
What is the InChIKey of 2-methylheptan-3-one;hydrate?
The InChIKey is NWIAGLORZKWPFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.H2O/c1-4-5-6-8(9)7(2)3;/h7H,4-6H2,1-3H3;1H2.
What are the key properties of 2-methylheptan-3-one;hydrate?
2-methylheptan-3-one;hydrate has a molecular weight of 146.23 g/mol, XLogP of 1.58, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylheptan-3-one;hydrate is sourced from PubChem (CID 176897102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).