About 1,1-diiodohexan-2-one
1,1-diiodohexan-2-one (PubChem CID 12616826) has the molecular formula C6H10I2O
and a molecular weight of 351.95 g/mol. Its IUPAC name is 1,1-diiodohexan-2-one.
Molecular Properties
| Compound Name | 1,1-diiodohexan-2-one |
| PubChem CID | 12616826 |
| Molecular Formula | C6H10I2O |
| Molecular Weight | 351.95 g/mol |
| Exact Mass | 351.88 |
| IUPAC Name | 1,1-diiodohexan-2-one |
| SMILES | CCCCC(=O)C(I)I |
| InChI | InChI=1S/C6H10I2O/c1-2-3-4-5(9)6(7)8/h6H,2-4H2,1H3 |
| InChIKey | GIPAZQLIJWYUNZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.95 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diiodohexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diiodohexan-2-one?
The IUPAC name of 1,1-diiodohexan-2-one (CID 12616826) is 1,1-diiodohexan-2-one.
What is the SMILES notation for 1,1-diiodohexan-2-one?
The canonical SMILES for 1,1-diiodohexan-2-one is CCCCC(=O)C(I)I.
What is the InChIKey of 1,1-diiodohexan-2-one?
The InChIKey is GIPAZQLIJWYUNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10I2O/c1-2-3-4-5(9)6(7)8/h6H,2-4H2,1H3.
What are the key properties of 1,1-diiodohexan-2-one?
1,1-diiodohexan-2-one has a molecular weight of 351.95 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diiodohexan-2-one is sourced from PubChem (CID 12616826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).