About (4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one
(4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one (PubChem CID 162100012) has the molecular formula C20H40O2
and a molecular weight of 312.54 g/mol. Its IUPAC name is (4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one.
Molecular Properties
| Compound Name | (4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one |
| PubChem CID | 162100012 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | (4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one |
| SMILES | CCCCC(=O)[C@@H](C)CCC.CCCCC(=O)[C@H](C)CCC |
| InChI | InChI=1S/2C10H20O/c2*1-4-6-8-10(11)9(3)7-5-2/h2*9H,4-8H2,1-3H3/t2*9-/m10/s1 |
| InChIKey | ZETGIMOKGDAEBM-IGXPJQGBSA-N |
| XLogP | 6.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one?
The IUPAC name of (4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one (CID 162100012) is (4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one.
What is the SMILES notation for (4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one?
The canonical SMILES for (4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one is CCCCC(=O)[C@@H](C)CCC.CCCCC(=O)[C@H](C)CCC.
What is the InChIKey of (4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one?
The InChIKey is ZETGIMOKGDAEBM-IGXPJQGBSA-N. The full InChI is InChI=1S/2C10H20O/c2*1-4-6-8-10(11)9(3)7-5-2/h2*9H,4-8H2,1-3H3/t2*9-/m10/s1.
What are the key properties of (4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one?
(4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one has a molecular weight of 312.54 g/mol, XLogP of 6.36, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-methylnonan-5-one;(4R)-4-methylnonan-5-one is sourced from PubChem (CID 162100012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).