C17H27NO3 — CID 122493730
1-(9-methyl-8-oxododecyl)pyrrole-2,5-dione (PubChem CID 122493730) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(9-methyl-8-oxododecyl)pyrrole-2,5-dione.
| Compound Name | 1-(9-methyl-8-oxododecyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 122493730 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-(9-methyl-8-oxododecyl)pyrrole-2,5-dione |
| SMILES | CCCC(C)C(=O)CCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H27NO3/c1-3-9-14(2)15(19)10-7-5-4-6-8-13-18-16(20)11-12-17(18)21/h11-12,14H,3-10,13H2,1-2H3 |
| InChIKey | GFFWBFFVESSZIK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|