C10H14ClNO4 — CID 24763401
6-(2,5-dioxopyrrol-1-yl)hexanoic acid;hydrochloride (PubChem CID 24763401) has the molecular formula C10H14ClNO4 and a molecular weight of 247.68 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)hexanoic acid;hydrochloride.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 24763401 |
| Molecular Formula | C10H14ClNO4 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)hexanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H13NO4.ClH/c12-8-5-6-9(13)11(8)7-3-1-2-4-10(14)15;/h5-6H,1-4,7H2,(H,14,15);1H |
| InChIKey | RGTUTDCJZRNQHL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|