C15H27NO3 — CID 145323318
ethane;1-(6-oxoheptyl)pyrrole-2,5-dione (PubChem CID 145323318) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is ethane;1-(6-oxoheptyl)pyrrole-2,5-dione.
| Compound Name | ethane;1-(6-oxoheptyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 145323318 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | ethane;1-(6-oxoheptyl)pyrrole-2,5-dione |
| SMILES | CC.CC.CC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H15NO3.2C2H6/c1-9(13)5-3-2-4-8-12-10(14)6-7-11(12)15;2*1-2/h6-7H,2-5,8H2,1H3;2*1-2H3 |
| InChIKey | RUGXXXVSFYVQOX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|