C24H43NO2 — CID 129182834
1-(9,10-dimethyloctadecyl)pyrrole-2,5-dione (PubChem CID 129182834) has the molecular formula C24H43NO2 and a molecular weight of 377.61 g/mol. Its IUPAC name is 1-(9,10-dimethyloctadecyl)pyrrole-2,5-dione.
| Compound Name | 1-(9,10-dimethyloctadecyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 129182834 |
| Molecular Formula | C24H43NO2 |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 377.33 |
| IUPAC Name | 1-(9,10-dimethyloctadecyl)pyrrole-2,5-dione |
| SMILES | CCCCCCCCC(C)C(C)CCCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C24H43NO2/c1-4-5-6-7-10-13-16-21(2)22(3)17-14-11-8-9-12-15-20-25-23(26)18-19-24(25)27/h18-19,21-22H,4-17,20H2,1-3H3 |
| InChIKey | GDBAPGPEHVDTIG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|