C22H38N2O2 — CID 89021047
1-[6-[[(5S)-undecan-5-yl]amino]hept-6-enyl]pyrrole-2,5-dione (PubChem CID 89021047) has the molecular formula C22H38N2O2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 1-[6-[[(5S)-undecan-5-yl]amino]hept-6-enyl]pyrrole-2,5-dione.
| Compound Name | 1-[6-[[(5S)-undecan-5-yl]amino]hept-6-enyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 89021047 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | 1-[6-[[(5S)-undecan-5-yl]amino]hept-6-enyl]pyrrole-2,5-dione |
| SMILES | C=C(CCCCCN1C(=O)C=CC1=O)N[C@@H](CCCC)CCCCCC |
| InChI | InChI=1S/C22H38N2O2/c1-4-6-8-11-15-20(14-7-5-2)23-19(3)13-10-9-12-18-24-21(25)16-17-22(24)26/h16-17,20,23H,3-15,18H2,1-2H3/t20-/m0/s1 |
| InChIKey | LGOGMBAMCVDIML-FQEVSTJZSA-N |
| XLogP | 5.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|