C8H15NO2Si — CID 160820729
1-butylpyrrole-2,5-dione;silane (PubChem CID 160820729) has the molecular formula C8H15NO2Si and a molecular weight of 185.30 g/mol. Its IUPAC name is 1-butylpyrrole-2,5-dione;silane.
| Compound Name | 1-butylpyrrole-2,5-dione;silane |
|---|---|
| PubChem CID | 160820729 |
| Molecular Formula | C8H15NO2Si |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 1-butylpyrrole-2,5-dione;silane |
| SMILES | CCCCN1C(=O)C=CC1=O.[SiH4] |
| InChI | InChI=1S/C8H11NO2.H4Si/c1-2-3-6-9-7(10)4-5-8(9)11;/h4-5H,2-3,6H2,1H3;1H4 |
| InChIKey | SFMYZNZQUBGQOB-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|