C44H74N2O4 — CID 164776468
1-[7-[2-[7-(2,5-dioxopyrrol-1-yl)heptyl]-4-heptyl-3-nonylcyclohexyl]heptyl]pyrrole-2,5-dione (PubChem CID 164776468) has the molecular formula C44H74N2O4 and a molecular weight of 695.09 g/mol. Its IUPAC name is 1-[7-[2-[7-(2,5-dioxopyrrol-1-yl)heptyl]-4-heptyl-3-nonylcyclohexyl]heptyl]pyrrole-2,5-dione.
| Compound Name | 1-[7-[2-[7-(2,5-dioxopyrrol-1-yl)heptyl]-4-heptyl-3-nonylcyclohexyl]heptyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 164776468 |
| Molecular Formula | C44H74N2O4 |
| Molecular Weight | 695.09 g/mol |
| Exact Mass | 694.56 |
| IUPAC Name | 1-[7-[2-[7-(2,5-dioxopyrrol-1-yl)heptyl]-4-heptyl-3-nonylcyclohexyl]heptyl]pyrrole-2,5-dione |
| SMILES | CCCCCCCCCC1C(CCCCCCC)CCC(CCCCCCCN2C(=O)C=CC2=O)C1CCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C44H74N2O4/c1-3-5-7-9-10-15-21-27-39-37(25-19-13-8-6-4-2)29-30-38(26-20-14-11-17-23-35-45-41(47)31-32-42(45)48)40(39)28-22-16-12-18-24-36-46-43(49)33-34-44(46)50/h31-34,37-40H,3-30,35-36H2,1-2H3 |
| InChIKey | MHFTYGXCILRWME-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.09 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|